ChemNet > CAS > 280556-71-0 (4-morpholinophenyl)methanol
280556-71-0 (4-morpholinophenyl)methanol
Ürün Adı |
(4-morpholinophenyl)methanol |
Eş anlamlı |
(4-Morpholin-4-yl-phenyl)-methanol |
Moleküler Formülü |
C11H15NO2 |
Molekül Ağırlığı |
193.2423 |
InChI |
InChI=1/C11H15NO2/c13-9-10-1-3-11(4-2-10)12-5-7-14-8-6-12/h1-4,13H,5-9H2 |
CAS kayıt numarası |
280556-71-0 |
Moleküler Yapısı |
|
Yoğunluk |
1.16g/cm3 |
Kaynama noktası |
378.4°C at 760 mmHg |
Kırılma indisi |
1.568 |
Alevlenme noktası |
182.7°C |
Tehlike Sembolleri |
Xi:Irritant;
|
Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|