ChemNet > CAS > 2855-27-8 1,2,4-Trivinylcyclohexane, mixture of isomers
2855-27-8 1,2,4-Trivinylcyclohexane, mixture of isomers
Ürün Adı |
1,2,4-Trivinylcyclohexane, mixture of isomers |
Eş anlamlı |
cyclohexane-1,2,4-triyltris(ethylene); 1,2,4-Trivinyl cyclohexane = TVCH; 1,2,4-Trivinylcyclohexane; 1,2,4-triethenylcyclohexane |
Moleküler Formülü |
C12H18 |
Molekül Ağırlığı |
162.2713 |
InChI |
InChI=1/C12H18/c1-4-10-7-8-11(5-2)12(6-3)9-10/h4-6,10-12H,1-3,7-9H2 |
CAS kayıt numarası |
2855-27-8 |
EINECS |
220-668-9 |
Moleküler Yapısı |
|
Yoğunluk |
0.96g/cm3 |
Kaynama noktası |
198.4°C at 760 mmHg |
Kırılma indisi |
1.628 |
Alevlenme noktası |
68.9°C |
Tehlike Sembolleri |
Xi:Irritant;
|
Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S24/25:Avoid contact with skin and eyes.;
|
|