ChemNet > CAS > 3033-82-7 8-Chloroquinaldine
3033-82-7 8-Chloroquinaldine
| Ürün Adı |
8-Chloroquinaldine |
| Eş anlamlı |
8-Chloro-2-methylquinoline; 2-Methyl-8-chloroquinoline |
| Moleküler Formülü |
C10H8ClN |
| Molekül Ağırlığı |
177.6302 |
| InChI |
InChI=1/C10H8ClN/c1-7-5-6-8-3-2-4-9(11)10(8)12-7/h2-6H,1H3 |
| CAS kayıt numarası |
3033-82-7 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.225g/cm3 |
| Ergime noktası |
64-66℃ |
| Kaynama noktası |
278.2°C at 760 mmHg |
| Kırılma indisi |
1.634 |
| Alevlenme noktası |
148.7°C |
| Tehlike Sembolleri |
 Xi:Irritant;
|
| Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
