ChemNet > CAS > 30711-40-1 2-(n-Heptanoyl)thiophene
30711-40-1 2-(n-Heptanoyl)thiophene
Ürün Adı |
2-(n-Heptanoyl)thiophene |
Eş anlamlı |
1-(2-Thienoyl)hexane; 1-(thiophen-2-yl)heptan-1-one |
Moleküler Formülü |
C11H16OS |
Molekül Ağırlığı |
196.3091 |
InChI |
InChI=1/C11H16OS/c1-2-3-4-5-7-10(12)11-8-6-9-13-11/h6,8-9H,2-5,7H2,1H3 |
CAS kayıt numarası |
30711-40-1 |
Moleküler Yapısı |
|
Yoğunluk |
1.017g/cm3 |
Kaynama noktası |
295.9°C at 760 mmHg |
Kırılma indisi |
1.511 |
Alevlenme noktası |
132.7°C |
Tehlike Sembolleri |
|
Risk Kodları |
|
Güvenlik Açıklaması |
S24/25:Avoid contact with skin and eyes.;
|
|