ChemNet > CAS > 30711-41-2 2-Octanoylthiophene
30711-41-2 2-Octanoylthiophene
Ürün Adı |
2-Octanoylthiophene |
Eş anlamlı |
n-Heptyl 2-thienyl ketone; 1-(thiophen-2-yl)octan-1-one |
Moleküler Formülü |
C12H18OS |
Molekül Ağırlığı |
210.3357 |
InChI |
InChI=1/C12H18OS/c1-2-3-4-5-6-8-11(13)12-9-7-10-14-12/h7,9-10H,2-6,8H2,1H3 |
CAS kayıt numarası |
30711-41-2 |
Moleküler Yapısı |
|
Yoğunluk |
1.004g/cm3 |
Kaynama noktası |
312°C at 760 mmHg |
Kırılma indisi |
1.508 |
Alevlenme noktası |
142.5°C |
Tehlike Sembolleri |
|
Risk Kodları |
|
Güvenlik Açıklaması |
S24/25:Avoid contact with skin and eyes.;
|
|