CAS No: 3083-10-1, Chemical Name: 1,1,4,7,10,10-hexamethyltriethylene-tetramine
the physical and chemical property of 3083-10-1, 1,1,4,7,10,10-hexamethyltriethylene-tetramine is provided by ChemNet.com
ChemNet > CAS > 3083-10-1 1,1,4,7,10,10-hexamethyltriethylene-tetramine
3083-10-1 1,1,4,7,10,10-hexamethyltriethylene-tetramine
Ürün Adı |
1,1,4,7,10,10-hexamethyltriethylene-tetramine |
Eş anlamlı |
1,1,4,7,10,10-Hexamethyltriethylenetetramine; N~1~,N~1~'-ethane-1,2-diylbis(N~1~,N~2~,N~2~-trimethylethane-1,2-diamine) |
Moleküler Formülü |
C12H30N4 |
Molekül Ağırlığı |
230.3934 |
InChI |
InChI=1/C12H30N4/c1-13(2)7-9-15(5)11-12-16(6)10-8-14(3)4/h7-12H2,1-6H3 |
CAS kayıt numarası |
3083-10-1 |
EINECS |
221-382-7 |
Moleküler Yapısı |
|
Yoğunluk |
0.901g/cm3 |
Kaynama noktası |
260.4°C at 760 mmHg |
Kırılma indisi |
1.479 |
Alevlenme noktası |
101.7°C |
Tehlike Sembolleri |
|
Risk Kodları |
|
Güvenlik Açıklaması |
|
|