ChemNet > CAS > 3084-53-5 Trimethylsulfoniumbromide
3084-53-5 Trimethylsulfoniumbromide
Ürün Adı |
Trimethylsulfoniumbromide |
Eş anlamlı |
Trimethylsulfonium bromide; Trimethylsulphonium bromide; trimethylsulfonium; Trimethyl-sulfoniubromide; Sulfonium, trimethyl-, bromide |
Moleküler Formülü |
C3H9BrS |
Molekül Ağırlığı |
157.0726 |
InChI |
InChI=1/C3H9S.BrH/c1-4(2)3;/h1-3H3;1H/q+1;/p-1 |
CAS kayıt numarası |
3084-53-5 |
Moleküler Yapısı |
|
Ergime noktası |
203℃ |
Tehlike Sembolleri |
|
Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|