ChemNet > CAS > 30955-94-3 2-Acetyl-5-iodothiophene
30955-94-3 2-Acetyl-5-iodothiophene
| Ürün Adı |
2-Acetyl-5-iodothiophene |
| Eş anlamlı |
NSC 80387; 1-(5-iodothiophen-2-yl)ethanone |
| Moleküler Formülü |
C6H5IOS |
| Molekül Ağırlığı |
252.0728 |
| InChI |
InChI=1/C6H5IOS/c1-4(8)5-2-3-6(7)9-5/h2-3H,1H3 |
| CAS kayıt numarası |
30955-94-3 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.902g/cm3 |
| Kaynama noktası |
306.2°C at 760 mmHg |
| Kırılma indisi |
1.637 |
| Alevlenme noktası |
139°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
