ChemNet > CAS > 32265-82-0 4-Bromo-2,6-dimethylisothiocyanatobenzene
32265-82-0 4-Bromo-2,6-dimethylisothiocyanatobenzene
| Ürün Adı |
4-Bromo-2,6-dimethylisothiocyanatobenzene |
| Eş anlamlı |
4-Bromo-2,6-dimethylphenyl isothiocyanate; 5-bromo-2-isothiocyanato-1,3-dimethylbenzene |
| Moleküler Formülü |
C9H8BrNS |
| Molekül Ağırlığı |
242.1355 |
| InChI |
InChI=1/C9H8BrNS/c1-6-3-8(10)4-7(2)9(6)11-5-12/h3-4H,1-2H3 |
| CAS kayıt numarası |
32265-82-0 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.39g/cm3 |
| Kaynama noktası |
321.2°C at 760 mmHg |
| Kırılma indisi |
1.597 |
| Alevlenme noktası |
148.1°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
