ChemNet > CAS > 32890-90-7 6-Chloro-2-fluoro-3-methylbenzoic acid
32890-90-7 6-Chloro-2-fluoro-3-methylbenzoic acid
| Ürün Adı |
6-Chloro-2-fluoro-3-methylbenzoic acid |
| Eş anlamlı |
6-Chloro-2-fluoro-m-toluic acid |
| Moleküler Formülü |
C8H6ClFO2 |
| Molekül Ağırlığı |
188.5834 |
| InChI |
InChI=1/C8H6ClFO2/c1-4-2-3-5(9)6(7(4)10)8(11)12/h2-3H,1H3,(H,11,12) |
| CAS kayıt numarası |
32890-90-7 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.403g/cm3 |
| Kaynama noktası |
279.7°C at 760 mmHg |
| Kırılma indisi |
1.551 |
| Alevlenme noktası |
123°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
