CAS No: 3385-61-3, Chemical Name: 3a,4,5,6,7,7a-Hexahydro-4,7-methano-1H-inden-6-ol
the physical and chemical property of 3385-61-3, 3a,4,5,6,7,7a-Hexahydro-4,7-methano-1H-inden-6-ol is provided by ChemNet.com
ChemNet > CAS > 3385-61-3 3a,4,5,6,7,7a-Hexahydro-4,7-methano-1H-inden-6-ol
3385-61-3 3a,4,5,6,7,7a-Hexahydro-4,7-methano-1H-inden-6-ol
| Ürün Adı |
3a,4,5,6,7,7a-Hexahydro-4,7-methano-1H-inden-6-ol |
| Eş anlamlı |
Tricyclo(5.2.1.02,6)dec-3-en-8-ol; 3a,4,5,6,7,7a-Hexahydro-4,7-Methanoinden-6-ol; 4,7-Methano-1H-inden-6-ol, 3a,4,5,6,7,7a-hexahydro-; 3a,4,5,6,7,7a-hexahydro-1H-4,7-methanoinden-6-ol; hexahydromethanoinden-6-ol |
| Moleküler Formülü |
C10H14O |
| Molekül Ağırlığı |
150.2176 |
| InChI |
InChI=1/C10H14O/c11-10-5-6-4-9(10)8-3-1-2-7(6)8/h1-2,6-11H,3-5H2 |
| CAS kayıt numarası |
3385-61-3 |
| EINECS |
222-197-4 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.157g/cm3 |
| Kaynama noktası |
245.9°C at 760 mmHg |
| Kırılma indisi |
1.583 |
| Alevlenme noktası |
90.2°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
|
| Güvenlik Açıklaması |
|
|
