ChemNet > CAS > 33974-27-5 phenyl(4-pyridyl)methanol
33974-27-5 phenyl(4-pyridyl)methanol
Ürün Adı |
phenyl(4-pyridyl)methanol |
Eş anlamlı |
alpha-Phenylpyridine-4-methanol; phenyl(pyridin-4-yl)methanol |
Moleküler Formülü |
C12H11NO |
Molekül Ağırlığı |
185.2218 |
InChI |
InChI=1/C12H11NO/c14-12(10-4-2-1-3-5-10)11-6-8-13-9-7-11/h1-9,12,14H |
CAS kayıt numarası |
33974-27-5 |
EINECS |
251-770-1 |
Moleküler Yapısı |
|
Yoğunluk |
1.155g/cm3 |
Ergime noktası |
120℃ |
Kaynama noktası |
353.5°C at 760 mmHg |
Kırılma indisi |
1.604 |
Alevlenme noktası |
167.6°C |
Tehlike Sembolleri |
Xn:Harmful;
|
Risk Kodları |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|