CAS No: 35065-29-3, Chemical Name: 2,2',3,4,4',5,5'-heptachlorobiphenyl
the physical and chemical property of 35065-29-3, 2,2',3,4,4',5,5'-heptachlorobiphenyl is provided by ChemNet.com
ChemNet > CAS > 35065-29-3 2,2',3,4,4',5,5'-heptachlorobiphenyl
35065-29-3 2,2',3,4,4',5,5'-heptachlorobiphenyl
| Ürün Adı |
2,2',3,4,4',5,5'-heptachlorobiphenyl |
| Eş anlamlı |
1,1'-biphenyl, 2,2',3,4,4',5,5'-heptachloro-; 2,2',3,4,4',5,5'-Heptachlorobiphenyl; 2,2',3,4,4',5,5'-PCB |
| Moleküler Formülü |
C12H3Cl7 |
| Molekül Ağırlığı |
395.3232 |
| InChI |
InChI=1/C12H3Cl7/c13-6-3-8(15)7(14)1-4(6)5-2-9(16)11(18)12(19)10(5)17/h1-3H |
| CAS kayıt numarası |
35065-29-3 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.658g/cm3 |
| Kaynama noktası |
424.3°C at 760 mmHg |
| Kırılma indisi |
1.632 |
| Alevlenme noktası |
210.9°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
|
| Güvenlik Açıklaması |
|
|
