ChemNet > CAS > 35696-77-6 2,4-Dimethoxyphenylthiourea
35696-77-6 2,4-Dimethoxyphenylthiourea
| Ürün Adı |
2,4-Dimethoxyphenylthiourea |
| Eş anlamlı |
1-(2,4-DIMETHOXYPHENYL)-2-THIOUREA; 1-(2,4-dimethoxyphenyl)thiourea |
| Moleküler Formülü |
C9H12N2O2S |
| Molekül Ağırlığı |
212.2688 |
| InChI |
InChI=1/C9H12N2O2S/c1-12-6-3-4-7(11-9(10)14)8(5-6)13-2/h3-5H,1-2H3,(H3,10,11,14) |
| CAS kayıt numarası |
35696-77-6 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.282g/cm3 |
| Kaynama noktası |
352.5°C at 760 mmHg |
| Kırılma indisi |
1.645 |
| Alevlenme noktası |
167°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R25:Toxic if swallowed.;
|
| Güvenlik Açıklaması |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
