ChemNet > CAS > 36401-55-5 5-methyl-2-phenyl-2H-1,2,3-triazole-4-carbonyl chloride
36401-55-5 5-methyl-2-phenyl-2H-1,2,3-triazole-4-carbonyl chloride
| Ürün Adı |
5-methyl-2-phenyl-2H-1,2,3-triazole-4-carbonyl chloride |
| Moleküler Formülü |
C10H8ClN3O |
| Molekül Ağırlığı |
221.643 |
| InChI |
InChI=1/C10H8ClN3O/c1-7-9(10(11)15)13-14(12-7)8-5-3-2-4-6-8/h2-6H,1H3 |
| CAS kayıt numarası |
36401-55-5 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.36g/cm3 |
| Ergime noktası |
105℃ |
| Kaynama noktası |
374.6°C at 760 mmHg |
| Kırılma indisi |
1.644 |
| Alevlenme noktası |
180.3°C |
| Tehlike Sembolleri |
 C:Corrosive;
|
| Risk Kodları |
R34:Causes burns.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
