ChemNet > CAS > 36401-55-5 5-methyl-2-phenyl-2H-1,2,3-triazole-4-carbonyl chloride
36401-55-5 5-methyl-2-phenyl-2H-1,2,3-triazole-4-carbonyl chloride
Ürün Adı |
5-methyl-2-phenyl-2H-1,2,3-triazole-4-carbonyl chloride |
Moleküler Formülü |
C10H8ClN3O |
Molekül Ağırlığı |
221.643 |
InChI |
InChI=1/C10H8ClN3O/c1-7-9(10(11)15)13-14(12-7)8-5-3-2-4-6-8/h2-6H,1H3 |
CAS kayıt numarası |
36401-55-5 |
Moleküler Yapısı |
|
Yoğunluk |
1.36g/cm3 |
Ergime noktası |
105℃ |
Kaynama noktası |
374.6°C at 760 mmHg |
Kırılma indisi |
1.644 |
Alevlenme noktası |
180.3°C |
Tehlike Sembolleri |
C:Corrosive;
|
Risk Kodları |
R34:Causes burns.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|