ChemNet > CAS > 3681-71-8 cis-3-hexenyl acetate
3681-71-8 cis-3-hexenyl acetate
| Ürün Adı |
cis-3-hexenyl acetate |
| Eş anlamlı |
Cis-3-Hexene-1-Yl Acetate; 3-Hexen-1-ol, acetate, (Z)-; ACETATO DE CIS-3-HEXENILO; Leaf acetate; Verdural extra; (Z)-3-hexenyl acetate |
| Moleküler Formülü |
C8H14O2 |
| Molekül Ağırlığı |
142.2 |
| InChI |
InChI=1/C8H14O2/c1-3-4-5-6-7-10-8(2)9/h4-5H,3,6-7H2,1-2H3/b5-4- |
| CAS kayıt numarası |
3681-71-8 |
| EINECS |
222-960-1 |
| Moleküler Yapısı |
|
| Yoğunluk |
0.897 |
| Kaynama noktası |
75-76℃ (23 mmHg) |
| Kırılma indisi |
1.427 |
| Alevlenme noktası |
135�H |
| Tehlike Sembolleri |
|
| Risk Kodları |
R36/38:Irritating to eyes and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
