ChemNet > CAS > 3696-22-8 1-(4-nitrophenyl)-2-thiourea
3696-22-8 1-(4-nitrophenyl)-2-thiourea
Ürün Adı |
1-(4-nitrophenyl)-2-thiourea |
Eş anlamlı |
4-Nitrophenylthiourea; 1-(4-nitrophenyl)thiourea |
Moleküler Formülü |
C7H7N3O2S |
Molekül Ağırlığı |
197.2144 |
InChI |
InChI=1/C7H7N3O2S/c8-7(13)9-5-1-3-6(4-2-5)10(11)12/h1-4H,(H3,8,9,13) |
CAS kayıt numarası |
3696-22-8 |
EINECS |
223-021-9 |
Moleküler Yapısı |
|
Yoğunluk |
1.524g/cm3 |
Ergime noktası |
206℃ |
Kaynama noktası |
365.5°C at 760 mmHg |
Kırılma indisi |
1.759 |
Alevlenme noktası |
174.9°C |
Tehlike Sembolleri |
|
Risk Kodları |
R25:Toxic if swallowed.;
|
Güvenlik Açıklaması |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|