ChemNet > CAS > 37798-08-6 1-Benzofuran-5-ylmethylamine
37798-08-6 1-Benzofuran-5-ylmethylamine
| Ürün Adı |
1-Benzofuran-5-ylmethylamine |
| Eş anlamlı |
1-(1-benzofuran-5-yl)methanamine |
| Moleküler Formülü |
C9H9NO |
| Molekül Ağırlığı |
147.1739 |
| InChI |
InChI=1/C9H9NO/c10-6-7-1-2-9-8(5-7)3-4-11-9/h1-5H,6,10H2 |
| CAS kayıt numarası |
37798-08-6 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.164g/cm3 |
| Kaynama noktası |
254.3°C at 760 mmHg |
| Kırılma indisi |
1.628 |
| Alevlenme noktası |
107.6°C |
| Tehlike Sembolleri |
 C:Corrosive;
|
| Risk Kodları |
R34:Causes burns.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
