ChemNet > CAS > 37885-41-9 1-(2,4-Dichlorophenyl)-1-propanone
37885-41-9 1-(2,4-Dichlorophenyl)-1-propanone
Ürün Adı |
1-(2,4-Dichlorophenyl)-1-propanone |
Eş anlamlı |
2,4-Dichloropropiophenone; 2',4'-DICHLOROPROPIOPHENONE |
Moleküler Formülü |
C9H8Cl2O |
Molekül Ağırlığı |
203.06 |
InChI |
InChI=1/C9H8Cl2O/c1-2-9(12)7-4-3-6(10)5-8(7)11/h3-5H,2H2,1H3 |
CAS kayıt numarası |
37885-41-9 |
EINECS |
253-700-5 |
Moleküler Yapısı |
|
Yoğunluk |
1.287 |
Kırılma indisi |
1.551-1.553 |
Tehlike Sembolleri |
Xi:Irritant;
|
Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|