ChemNet > CAS > 3857-25-8 5-Methyl-2-furanmethanol
3857-25-8 5-Methyl-2-furanmethanol
| Ürün Adı |
5-Methyl-2-furanmethanol |
| Eş anlamlı |
(5-Methyl-2-furyl)methanol; (5-methylfuran-2-yl)methanol |
| Moleküler Formülü |
C6H8O2 |
| Molekül Ağırlığı |
112.1265 |
| InChI |
InChI=1/C6H8O2/c1-5-2-3-6(4-7)8-5/h2-3,7H,4H2,1H3 |
| CAS kayıt numarası |
3857-25-8 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.095g/cm3 |
| Kaynama noktası |
178.5°C at 760 mmHg |
| Kırılma indisi |
1.494 |
| Alevlenme noktası |
61.8°C |
| Tehlike Sembolleri |
 Xn:Harmful;
|
| Risk Kodları |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Güvenlik Açıklaması |
S36/37:Wear suitable protective clothing and gloves.;
|
|
