ChemNet > CAS > 39593-08-3 Methylphenylpiperazine
39593-08-3 Methylphenylpiperazine
| Ürün Adı |
Methylphenylpiperazine |
| Eş anlamlı |
1-(4-Methylphenyl)piperazine; N-(p-Tolyl)piperazine; 1-p-tolylpiperazine |
| Moleküler Formülü |
C11H16N2 |
| Molekül Ağırlığı |
176.2581 |
| InChI |
InChI=1/C11H16N2/c1-10-2-4-11(5-3-10)13-8-6-12-7-9-13/h2-5,12H,6-9H2,1H3 |
| CAS kayıt numarası |
39593-08-3 |
| EINECS |
254-534-6 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.012g/cm3 |
| Kaynama noktası |
321.2°C at 760 mmHg |
| Kırılma indisi |
1.54 |
| Alevlenme noktası |
153.8°C |
| Tehlike Sembolleri |
 Xi:Irritant;
|
| Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
