ChemNet > CAS > 39828-35-8 2,4- dimethoxybenzoyl chloride
39828-35-8 2,4- dimethoxybenzoyl chloride
| Ürün Adı |
2,4- dimethoxybenzoyl chloride |
| Eş anlamlı |
2,4-DIMETHOXYBENZOYL CHLORIDE; benzoyl chloride, 2,4-dimethoxy- |
| Moleküler Formülü |
C9H9ClO3 |
| Molekül Ağırlığı |
200.619 |
| InChI |
InChI=1/C9H9ClO3/c1-12-6-3-4-7(9(10)11)8(5-6)13-2/h3-5H,1-2H3 |
| CAS kayıt numarası |
39828-35-8 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.224g/cm3 |
| Ergime noktası |
58℃ |
| Kaynama noktası |
306.7°C at 760 mmHg |
| Kırılma indisi |
1.52 |
| Alevlenme noktası |
134.1°C |
| Tehlike Sembolleri |
 C:Corrosive;
|
| Risk Kodları |
R34:Causes burns.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
