ChemNet > CAS > 40004-08-8 N-(Carboethoxymethyl)piperazine
40004-08-8 N-(Carboethoxymethyl)piperazine
| Ürün Adı |
N-(Carboethoxymethyl)piperazine |
| Eş anlamlı |
Ethyl (1-piperazino)acetate; (1-Piperazino)acetic acid ethyl ester; 1-(Ethoxycarbonylmethyl)piperazine; ethyl piperazin-1-ylacetate; Ethyl 1-piperazinylacetate |
| Moleküler Formülü |
C8H16N2O2 |
| Molekül Ağırlığı |
172.2248 |
| InChI |
InChI=1/C8H16N2O2/c1-2-12-8(11)7-10-5-3-9-4-6-10/h9H,2-7H2,1H3 |
| CAS kayıt numarası |
40004-08-8 |
| EINECS |
254-745-3 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.027g/cm3 |
| Kaynama noktası |
252.5°C at 760 mmHg |
| Kırılma indisi |
1.457 |
| Alevlenme noktası |
106.5°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R36/38:Irritating to eyes and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
