ChemNet > CAS > 40397-90-8 3-Chloro-2-methylphenyl isocyanate
40397-90-8 3-Chloro-2-methylphenyl isocyanate
| Ürün Adı |
3-Chloro-2-methylphenyl isocyanate |
| Eş anlamlı |
1-chloro-3-isocyanato-2-methylbenzene |
| Moleküler Formülü |
C8H6ClNO |
| Molekül Ağırlığı |
167.5923 |
| InChI |
InChI=1/C8H6ClNO/c1-6-7(9)3-2-4-8(6)10-5-11/h2-4H,1H3 |
| CAS kayıt numarası |
40397-90-8 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.17g/cm3 |
| Kaynama noktası |
241°C at 760 mmHg |
| Kırılma indisi |
1.543 |
| Alevlenme noktası |
90.1°C |
| Tehlike Sembolleri |
 Xn:Harmful;
|
| Risk Kodları |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
