ChemNet > CAS > 4104-75-0 N-methyl-N-phenylthiourea
4104-75-0 N-methyl-N-phenylthiourea
| Ürün Adı |
N-methyl-N-phenylthiourea |
| Eş anlamlı |
1-Methyl-1-phenylthiourea |
| Moleküler Formülü |
C8H10N2S |
| Molekül Ağırlığı |
166.2434 |
| InChI |
InChI=1/C8H10N2S/c1-10(8(9)11)7-5-3-2-4-6-7/h2-6H,1H3,(H2,9,11) |
| CAS kayıt numarası |
4104-75-0 |
| EINECS |
223-877-3 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.221g/cm3 |
| Ergime noktası |
101℃ |
| Kaynama noktası |
267.1°C at 760 mmHg |
| Kırılma indisi |
1.679 |
| Alevlenme noktası |
115.3°C |
| Tehlike Sembolleri |
 Xn:Harmful;
|
| Risk Kodları |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Güvenlik Açıklaması |
S37/39:Wear suitable gloves and eye/face protection.;
|
|
