ChemNet > CAS > 4341-24-6 5-Methylcyclohexane-1,3-dione
4341-24-6 5-Methylcyclohexane-1,3-dione
Ürün Adı |
5-Methylcyclohexane-1,3-dione |
Eş anlamlı |
(5S)-3-hydroxy-5-methylcyclohex-2-en-1-one |
Moleküler Formülü |
C7H10O2 |
Molekül Ağırlığı |
126.1531 |
InChI |
InChI=1/C7H10O2/c1-5-2-6(8)4-7(9)3-5/h4-5,8H,2-3H2,1H3/t5-/m0/s1 |
CAS kayıt numarası |
4341-24-6 |
Moleküler Yapısı |
|
Yoğunluk |
1.134g/cm3 |
Ergime noktası |
129-131℃ |
Kaynama noktası |
221.6°C at 760 mmHg |
Kırılma indisi |
1.517 |
Alevlenme noktası |
89.1°C |
Tehlike Sembolleri |
Xi:Irritant;
|
Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|