ChemNet > CAS > 4441-63-8 Cyclohexanebutyric acid
4441-63-8 Cyclohexanebutyric acid
| Ürün Adı |
Cyclohexanebutyric acid |
| Eş anlamlı |
4-Cyclohexylbutyric acid; cadmium bis(4-cyclohexylbutanoate); sodium 4-cyclohexylbutanoate; lead(2+) bis(4-cyclohexylbutanoate); lithium 4-cyclohexylbutanoate; mercury bis(4-cyclohexylbutanoate); potassium 4-cyclohexylbutanoate; silver(1+) 4-cyclohexylbutanoate; strontium bis(4-cyclohexylbutanoate); magnesium bis(4-cyclohexylbutanoate); 4-cyclohexylbutanoate |
| Moleküler Formülü |
C10H17O2 |
| Molekül Ağırlığı |
169.2413 |
| InChI |
InChI=1/C10H18O2/c11-10(12)8-4-7-9-5-2-1-3-6-9/h9H,1-8H2,(H,11,12)/p-1 |
| CAS kayıt numarası |
4441-63-8 |
| EINECS |
224-665-3 |
| Moleküler Yapısı |
|
| Ergime noktası |
27-31℃ |
| Kaynama noktası |
283.3°C at 760 mmHg |
| Alevlenme noktası |
138.9°C |
| Tehlike Sembolleri |
 Xi:Irritant;
|
| Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
