ChemNet > CAS > 446-09-3 2-Bromo-5-fluoronitrobenzene
446-09-3 2-Bromo-5-fluoronitrobenzene
Ürün Adı |
2-Bromo-5-fluoronitrobenzene |
Eş anlamlı |
1-Bromo-4-fluoro-2-nitrobenzene |
Moleküler Formülü |
C6H3BrFNO2 |
Molekül Ağırlığı |
219.9959 |
InChI |
InChI=1/C6H3BrFNO2/c7-5-2-1-4(8)3-6(5)9(10)11/h1-3H |
CAS kayıt numarası |
446-09-3 |
EINECS |
207-160-2 |
Moleküler Yapısı |
|
Yoğunluk |
1.808g/cm3 |
Ergime noktası |
37-39℃ |
Kaynama noktası |
220.9°C at 760 mmHg |
Kırılma indisi |
1.579 |
Alevlenme noktası |
87.4°C |
Tehlike Sembolleri |
|
Risk Kodları |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|