ChemNet > CAS > 4472-92-8 Cinnamylidenemalonic acid
4472-92-8 Cinnamylidenemalonic acid
| Ürün Adı |
Cinnamylidenemalonic acid |
| Eş anlamlı |
2-Carboxy-5-phenyl-2,4-pentadienoic acid; (3-phenylprop-2-en-1-ylidene)propanedioic acid; [(2E)-3-phenylprop-2-en-1-ylidene]propanedioic acid; [(2E)-3-phenylprop-2-en-1-ylidene]propanedioate |
| Moleküler Formülü |
C12H8O4 |
| Molekül Ağırlığı |
216.1906 |
| InChI |
InChI=1/C12H10O4/c13-11(14)10(12(15)16)8-4-7-9-5-2-1-3-6-9/h1-8H,(H,13,14)(H,15,16)/p-2/b7-4+ |
| CAS kayıt numarası |
4472-92-8 |
| EINECS |
224-746-3 |
| Moleküler Yapısı |
|
| Kaynama noktası |
484.6°C at 760 mmHg |
| Alevlenme noktası |
261°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
