ChemNet > CAS > 4491-92-3 1-(2-Cyanoethyl)-4-methylpiperazine
4491-92-3 1-(2-Cyanoethyl)-4-methylpiperazine
Ürün Adı |
1-(2-Cyanoethyl)-4-methylpiperazine |
Eş anlamlı |
3-(4-Methylpiperazino)propionitrile; 3-(4-methylpiperazin-1-yl)propanenitrile |
Moleküler Formülü |
C8H15N3 |
Molekül Ağırlığı |
153.2248 |
InChI |
InChI=1/C8H15N3/c1-10-5-7-11(8-6-10)4-2-3-9/h2,4-8H2,1H3 |
CAS kayıt numarası |
4491-92-3 |
Moleküler Yapısı |
|
Yoğunluk |
0.981g/cm3 |
Kaynama noktası |
273°C at 760 mmHg |
Kırılma indisi |
1.477 |
Alevlenme noktası |
113.6°C |
Tehlike Sembolleri |
|
Risk Kodları |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/38:Irritating to eyes and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|