ChemNet > CAS > 455-67-4 3-fluoropropiophenone
455-67-4 3-fluoropropiophenone
Ürün Adı |
3-fluoropropiophenone |
Eş anlamlı |
3'-FLUOROPROPIOPHENONE; 1-(3-fluorophenyl)propan-1-one |
Moleküler Formülü |
C9H9FO |
Molekül Ağırlığı |
152.1656 |
InChI |
InChI=1/C9H9FO/c1-2-9(11)7-4-3-5-8(10)6-7/h3-6H,2H2,1H3 |
CAS kayıt numarası |
455-67-4 |
Moleküler Yapısı |
|
Yoğunluk |
1.074g/cm3 |
Kaynama noktası |
209.8°C at 760 mmHg |
Kırılma indisi |
1.489 |
Alevlenme noktası |
79.8°C |
Tehlike Sembolleri |
|
Risk Kodları |
R36/38:Irritating to eyes and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|