ChemNet > CAS > 458-05-9 1-(3-fluorophenyl)-2-thiourea
458-05-9 1-(3-fluorophenyl)-2-thiourea
Ürün Adı |
1-(3-fluorophenyl)-2-thiourea |
Eş anlamlı |
3-Fluorophenylthiourea; 1-(3-fluorophenyl)thiourea |
Moleküler Formülü |
C7H7FN2S |
Molekül Ağırlığı |
170.2073 |
InChI |
InChI=1/C7H7FN2S/c8-5-2-1-3-6(4-5)10-7(9)11/h1-4H,(H3,9,10,11) |
CAS kayıt numarası |
458-05-9 |
Moleküler Yapısı |
|
Yoğunluk |
1.397g/cm3 |
Kaynama noktası |
259.3°C at 760 mmHg |
Kırılma indisi |
1.692 |
Alevlenme noktası |
110.6°C |
Tehlike Sembolleri |
|
Risk Kodları |
R25:Toxic if swallowed.;
|
Güvenlik Açıklaması |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|