ChemNet > CAS > 459-05-2 1-(4-fluorophenyl)-2-thiourea
459-05-2 1-(4-fluorophenyl)-2-thiourea
| Ürün Adı |
1-(4-fluorophenyl)-2-thiourea |
| Eş anlamlı |
4-Fluorophenylthiourea; 1-(4-fluorophenyl)thiourea |
| Moleküler Formülü |
C7H7FN2S |
| Molekül Ağırlığı |
170.2073 |
| InChI |
InChI=1/C7H7FN2S/c8-5-1-3-6(4-2-5)10-7(9)11/h1-4H,(H3,9,10,11) |
| CAS kayıt numarası |
459-05-2 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.397g/cm3 |
| Ergime noktası |
164℃ |
| Kaynama noktası |
264.2°C at 760 mmHg |
| Kırılma indisi |
1.692 |
| Alevlenme noktası |
113.6°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R25:Toxic if swallowed.;
|
| Güvenlik Açıklaması |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
