ChemNet > CAS > 4630-80-2 Methyl cyclopentanecarboxylate
4630-80-2 Methyl cyclopentanecarboxylate
Ürün Adı |
Methyl cyclopentanecarboxylate |
Eş anlamlı |
Cyclopentanecarboxylic acid methyl ester; Methyl cyclopentane carboxylate |
Moleküler Formülü |
C7H12O2 |
Molekül Ağırlığı |
128.169 |
InChI |
InChI=1/C7H12O2/c1-9-7(8)6-4-2-3-5-6/h6H,2-5H2,1H3 |
CAS kayıt numarası |
4630-80-2 |
EINECS |
225-049-7 |
Moleküler Yapısı |
|
Yoğunluk |
1.014g/cm3 |
Kaynama noktası |
159°C at 760 mmHg |
Kırılma indisi |
1.45 |
Alevlenme noktası |
43.6°C |
Tehlike Sembolleri |
|
Risk Kodları |
|
Güvenlik Açıklaması |
S24/25:Avoid contact with skin and eyes.;
|
|