ChemNet > CAS > 4640-68-0 3,4-Dichlorobenzoylacetonitrile
4640-68-0 3,4-Dichlorobenzoylacetonitrile
| Ürün Adı |
3,4-Dichlorobenzoylacetonitrile |
| Eş anlamlı |
3-(3,4-dichlorophenyl)-3-oxopropanenitrile |
| Moleküler Formülü |
C9H5Cl2NO |
| Molekül Ağırlığı |
214.0481 |
| InChI |
InChI=1/C9H5Cl2NO/c10-7-2-1-6(5-8(7)11)9(13)3-4-12/h1-2,5H,3H2 |
| CAS kayıt numarası |
4640-68-0 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.383g/cm3 |
| Kaynama noktası |
398.4°C at 760 mmHg |
| Kırılma indisi |
1.567 |
| Alevlenme noktası |
194.7°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
