ChemNet > CAS > 4651-82-5 2-aminothiophene-3-carbonitrile
4651-82-5 2-aminothiophene-3-carbonitrile
Ürün Adı |
2-aminothiophene-3-carbonitrile |
Eş anlamlı |
2-Amino-3-cyanothiophene; 2-Amino-3-thiophenecarbonitrile |
Moleküler Formülü |
C5H4N2S |
Molekül Ağırlığı |
124.1637 |
InChI |
InChI=1/C5H4N2S/c6-3-4-1-2-8-5(4)7/h1-2H,7H2 |
CAS kayıt numarası |
4651-82-5 |
Moleküler Yapısı |
|
Yoğunluk |
1.33g/cm3 |
Ergime noktası |
104℃ |
Kaynama noktası |
317.5°C at 760 mmHg |
Kırılma indisi |
1.627 |
Alevlenme noktası |
145.8°C |
Tehlike Sembolleri |
Xn:Harmful;
|
Risk Kodları |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Güvenlik Açıklaması |
S36/37:Wear suitable protective clothing and gloves.;
|
|