ChemNet > CAS > 465514-80-1 1-(3-fluorophenyl)-2-(3-methoxyphenyl)-1-ethanone
465514-80-1 1-(3-fluorophenyl)-2-(3-methoxyphenyl)-1-ethanone
| Ürün Adı |
1-(3-fluorophenyl)-2-(3-methoxyphenyl)-1-ethanone |
| Eş anlamlı |
1-(3-fluorophenyl)-2-(3-methoxyphenyl)ethanone |
| Moleküler Formülü |
C15H13FO2 |
| Molekül Ağırlığı |
244.2609 |
| InChI |
InChI=1/C15H13FO2/c1-18-14-7-2-4-11(8-14)9-15(17)12-5-3-6-13(16)10-12/h2-8,10H,9H2,1H3 |
| CAS kayıt numarası |
465514-80-1 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.163g/cm3 |
| Kaynama noktası |
367.4°C at 760 mmHg |
| Kırılma indisi |
1.555 |
| Alevlenme noktası |
170°C |
| Tehlike Sembolleri |
 Xi:Irritant;
|
| Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
