ChemNet > CAS > 499770-77-3 (1-Methyl-1H-1,2,3-benzotriazol-5-yl)methylamine
499770-77-3 (1-Methyl-1H-1,2,3-benzotriazol-5-yl)methylamine
| Ürün Adı |
(1-Methyl-1H-1,2,3-benzotriazol-5-yl)methylamine |
| Eş anlamlı |
1-(1-methyl-1H-benzotriazol-5-yl)methanamine |
| Moleküler Formülü |
C8H10N4 |
| Molekül Ağırlığı |
162.1918 |
| InChI |
InChI=1/C8H10N4/c1-12-8-3-2-6(5-9)4-7(8)10-11-12/h2-4H,5,9H2,1H3 |
| CAS kayıt numarası |
499770-77-3 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.34g/cm3 |
| Ergime noktası |
63℃ |
| Kaynama noktası |
350.7°C at 760 mmHg |
| Kırılma indisi |
1.691 |
| Alevlenme noktası |
165.9°C |
| Tehlike Sembolleri |
 C:Corrosive;
|
| Risk Kodları |
R20:Harmful by inhalation.;
R34:Causes burns.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
