ChemNet > CAS > 51932-77-5 2,5-Diethyl-3,4-diphenylcyclopentadienone
51932-77-5 2,5-Diethyl-3,4-diphenylcyclopentadienone
Ürün Adı |
2,5-Diethyl-3,4-diphenylcyclopentadienone |
Eş anlamlı |
2,5-Diethyl-3,4-diphenylcyclopenta-2,4-dien-1-one |
Moleküler Formülü |
C21H20O |
Molekül Ağırlığı |
288.3829 |
InChI |
InChI=1/C21H20O/c1-3-17-19(15-11-7-5-8-12-15)20(18(4-2)21(17)22)16-13-9-6-10-14-16/h5-14H,3-4H2,1-2H3 |
CAS kayıt numarası |
51932-77-5 |
EINECS |
257-523-4 |
Moleküler Yapısı |
|
Yoğunluk |
1.078g/cm3 |
Kaynama noktası |
447.8°C at 760 mmHg |
Kırılma indisi |
1.587 |
Alevlenme noktası |
195.6°C |
Tehlike Sembolleri |
|
Risk Kodları |
|
Güvenlik Açıklaması |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|