ChemNet > CAS > 5211-62-1 2-Methoxyphenylacetone
5211-62-1 2-Methoxyphenylacetone
| Ürün Adı |
2-Methoxyphenylacetone |
| Eş anlamlı |
2-Methoxybenzyl methyl ketone; 1-(2-Methoxyphenyl)-2-propanone; 1-(2-methoxyphenyl)propan-2-one |
| Moleküler Formülü |
C10H12O2 |
| Molekül Ağırlığı |
164.2011 |
| InChI |
InChI=1/C10H12O2/c1-8(11)7-9-5-3-4-6-10(9)12-2/h3-6H,7H2,1-2H3 |
| CAS kayıt numarası |
5211-62-1 |
| EINECS |
226-008-6 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.027g/cm3 |
| Ergime noktası |
127-130℃ (10 mmHg) |
| Kaynama noktası |
261.7°C at 760 mmHg |
| Kırılma indisi |
1.501 |
| Alevlenme noktası |
94°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
|
| Güvenlik Açıklaması |
S24/25:Avoid contact with skin and eyes.;
|
|
