ChemNet > CAS > 5211-62-1 2-Methoxyphenylacetone
5211-62-1 2-Methoxyphenylacetone
Ürün Adı |
2-Methoxyphenylacetone |
Eş anlamlı |
2-Methoxybenzyl methyl ketone; 1-(2-Methoxyphenyl)-2-propanone; 1-(2-methoxyphenyl)propan-2-one |
Moleküler Formülü |
C10H12O2 |
Molekül Ağırlığı |
164.2011 |
InChI |
InChI=1/C10H12O2/c1-8(11)7-9-5-3-4-6-10(9)12-2/h3-6H,7H2,1-2H3 |
CAS kayıt numarası |
5211-62-1 |
EINECS |
226-008-6 |
Moleküler Yapısı |
|
Yoğunluk |
1.027g/cm3 |
Ergime noktası |
127-130℃ (10 mmHg) |
Kaynama noktası |
261.7°C at 760 mmHg |
Kırılma indisi |
1.501 |
Alevlenme noktası |
94°C |
Tehlike Sembolleri |
|
Risk Kodları |
|
Güvenlik Açıklaması |
S24/25:Avoid contact with skin and eyes.;
|
|