ChemNet > CAS > 52222-87-4 6-Benzoyl-2-naphthol
52222-87-4 6-Benzoyl-2-naphthol
Ürün Adı |
6-Benzoyl-2-naphthol |
Eş anlamlı |
6-hydroxy-2-naphthyl phenyl ketone; (6-hydroxynaphthalen-2-yl)(phenyl)methanone |
Moleküler Formülü |
C17H12O2 |
Molekül Ağırlığı |
248.276 |
InChI |
InChI=1/C17H12O2/c18-16-9-8-13-10-15(7-6-14(13)11-16)17(19)12-4-2-1-3-5-12/h1-11,18H |
CAS kayıt numarası |
52222-87-4 |
EINECS |
257-755-6 |
Moleküler Yapısı |
|
Yoğunluk |
1.24g/cm3 |
Ergime noktası |
161-162℃ |
Kaynama noktası |
453.8°C at 760 mmHg |
Kırılma indisi |
1.681 |
Alevlenme noktası |
193.3°C |
Tehlike Sembolleri |
|
Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|