ChemNet > CAS > 52431-30-8 2,5-Dibromo-3,4-dinitrothiophene
52431-30-8 2,5-Dibromo-3,4-dinitrothiophene
Ürün Adı |
2,5-Dibromo-3,4-dinitrothiophene |
Eş anlamlı |
2,5-Dibromo-3,4-dinitrthiphene; AKOS 92299; 2,5-DIBROMO-3,4-DINITROTHIOPHENE 98+% |
Moleküler Formülü |
C4Br2N2O4S |
Molekül Ağırlığı |
331.9268 |
InChI |
InChI=1/C4Br2N2O4S/c5-3-1(7(9)10)2(8(11)12)4(6)13-3 |
CAS kayıt numarası |
52431-30-8 |
Moleküler Yapısı |
|
Yoğunluk |
2.459g/cm3 |
Kaynama noktası |
341.2°C at 760 mmHg |
Kırılma indisi |
1.716 |
Alevlenme noktası |
160.2°C |
Tehlike Sembolleri |
|
Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|