ChemNet > CAS > 5326-38-5 2-Iodo-5-nitrotoluene
5326-38-5 2-Iodo-5-nitrotoluene
Ürün Adı |
2-Iodo-5-nitrotoluene |
Eş anlamlı |
1-iodo-2-methyl-4-nitrobenzene; N-(1-methylethyl)phenazine-1-carboxamide |
Moleküler Formülü |
C16H15N3O |
Molekül Ağırlığı |
265.3098 |
InChI |
InChI=1/C16H15N3O/c1-10(2)17-16(20)11-6-5-9-14-15(11)19-13-8-4-3-7-12(13)18-14/h3-10H,1-2H3,(H,17,20) |
CAS kayıt numarası |
5326-38-5 |
EINECS |
226-204-1 |
Moleküler Yapısı |
|
Yoğunluk |
1.217g/cm3 |
Kaynama noktası |
531.5°C at 760 mmHg |
Kırılma indisi |
1.665 |
Alevlenme noktası |
275.2°C |
Tehlike Sembolleri |
|
Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|