ChemNet > CAS > 53293-00-8 5-Hexynoic acid
53293-00-8 5-Hexynoic acid
| Ürün Adı |
5-Hexynoic acid |
| Eş anlamlı |
Hex-5-ynoic acid; hex-5-ynoate |
| Moleküler Formülü |
C6H7O2 |
| Molekül Ağırlığı |
111.1191 |
| InChI |
InChI=1/C6H8O2/c1-2-3-4-5-6(7)8/h1H,3-5H2,(H,7,8)/p-1 |
| CAS kayıt numarası |
53293-00-8 |
| Moleküler Yapısı |
|
| Kaynama noktası |
220.6°C at 760 mmHg |
| Alevlenme noktası |
99.6°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R34:Causes burns.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
