ChemNet > CAS > 535-32-0 D-Ethionine
535-32-0 D-Ethionine
Ürün Adı |
D-Ethionine |
Eş anlamlı |
D-2-Amino-4-(ethylthio)butyric acid; S-ethyl-D-homocysteine |
Moleküler Formülü |
C6H13NO2S |
Molekül Ağırlığı |
163.2379 |
InChI |
InChI=1/C6H13NO2S/c1-2-10-4-3-5(7)6(8)9/h5H,2-4,7H2,1H3,(H,8,9)/t5-/m1/s1 |
CAS kayıt numarası |
535-32-0 |
EINECS |
208-612-1 |
Moleküler Yapısı |
|
Yoğunluk |
1.164g/cm3 |
Ergime noktası |
278℃ |
Kaynama noktası |
310.4°C at 760 mmHg |
Kırılma indisi |
1.523 |
Alevlenme noktası |
141.5°C |
Tehlike Sembolleri |
|
Risk Kodları |
R40:Possible risks of irreversible effects.;
|
Güvenlik Açıklaması |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|