ChemNet > CAS > 5412-69-1 5-Diethylamino-2-pentanol
5412-69-1 5-Diethylamino-2-pentanol
| Ürün Adı |
5-Diethylamino-2-pentanol |
| Eş anlamlı |
5-Diethylaminopentan-2-ol; (4S)-N,N-diethyl-4-hydroxypentan-1-aminium; (4R)-N,N-diethyl-4-hydroxypentan-1-aminium |
| Moleküler Formülü |
C9H22NO |
| Molekül Ağırlığı |
160.2765 |
| InChI |
InChI=1/C9H21NO/c1-4-10(5-2)8-6-7-9(3)11/h9,11H,4-8H2,1-3H3/p+1/t9-/m1/s1 |
| CAS kayıt numarası |
5412-69-1 |
| EINECS |
226-497-6 |
| Moleküler Yapısı |
|
| Kaynama noktası |
218.6°C at 760 mmHg |
| Alevlenme noktası |
70.2°C |
| Tehlike Sembolleri |
 Xi:Irritant;
|
| Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S24/25:Avoid contact with skin and eyes.;
|
|
