ChemNet > CAS > 5413-05-8 Ethyl 2-phenylacetoacetate
5413-05-8 Ethyl 2-phenylacetoacetate
Ürün Adı |
Ethyl 2-phenylacetoacetate |
Eş anlamlı |
2-Phenylacetoacetic acid ethyl ester; ethyl 3-oxo-2-phenylbutanoate; ethyl (2S)-3-oxo-2-phenylbutanoate |
Moleküler Formülü |
C12H14O3 |
Molekül Ağırlığı |
206.2378 |
InChI |
InChI=1/C12H14O3/c1-3-15-12(14)11(9(2)13)10-7-5-4-6-8-10/h4-8,11H,3H2,1-2H3/t11-/m1/s1 |
CAS kayıt numarası |
5413-05-8 |
EINECS |
226-500-0 |
Moleküler Yapısı |
|
Yoğunluk |
1.087g/cm3 |
Kaynama noktası |
281.6°C at 760 mmHg |
Kırılma indisi |
1.503 |
Alevlenme noktası |
119.2°C |
Tehlike Sembolleri |
|
Risk Kodları |
|
Güvenlik Açıklaması |
S24/25:Avoid contact with skin and eyes.;
|
|