ChemNet > CAS > 5432-85-9 4-iso-Propylcyclohexanone
5432-85-9 4-iso-Propylcyclohexanone
| Ürün Adı |
4-iso-Propylcyclohexanone |
| Eş anlamlı |
4-Isopropylcyclohexanone; 4-(propan-2-yl)cyclohexanone |
| Moleküler Formülü |
C9H16O |
| Molekül Ağırlığı |
140.2227 |
| InChI |
InChI=1/C9H16O/c1-7(2)8-3-5-9(10)6-4-8/h7-8H,3-6H2,1-2H3 |
| CAS kayıt numarası |
5432-85-9 |
| EINECS |
226-592-2 |
| Moleküler Yapısı |
|
| Yoğunluk |
0.904g/cm3 |
| Kaynama noktası |
195.6°C at 760 mmHg |
| Kırılma indisi |
1.449 |
| Alevlenme noktası |
65°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
|
| Güvenlik Açıklaması |
S24/25:Avoid contact with skin and eyes.;
|
|
