ChemNet > CAS > 5467-72-1 4-Bromophenacylamine hydrochloride
5467-72-1 4-Bromophenacylamine hydrochloride
| Ürün Adı |
4-Bromophenacylamine hydrochloride |
| Eş anlamlı |
2-Amino-4'-Bromoacetophenone Hydrochloride; 2-Amino-4'-bromoacetophenone HCl |
| Moleküler Formülü |
C8H8BrNO |
| Molekül Ağırlığı |
214.0592 |
| InChI |
InChI=1/C8H8BrNO/c9-7-3-1-6(2-4-7)8(11)5-10/h1-4H,5,10H2 |
| CAS kayıt numarası |
5467-72-1 |
| EINECS |
226-778-3 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.52g/cm3 |
| Ergime noktası |
265℃ |
| Kaynama noktası |
322.8°C at 760 mmHg |
| Kırılma indisi |
1.589 |
| Alevlenme noktası |
149°C |
| Tehlike Sembolleri |
 Xi:Irritant;
|
| Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
