ChemNet > CAS > 5467-72-1 4-Bromophenacylamine hydrochloride
5467-72-1 4-Bromophenacylamine hydrochloride
Ürün Adı |
4-Bromophenacylamine hydrochloride |
Eş anlamlı |
2-Amino-4'-Bromoacetophenone Hydrochloride; 2-Amino-4'-bromoacetophenone HCl |
Moleküler Formülü |
C8H8BrNO |
Molekül Ağırlığı |
214.0592 |
InChI |
InChI=1/C8H8BrNO/c9-7-3-1-6(2-4-7)8(11)5-10/h1-4H,5,10H2 |
CAS kayıt numarası |
5467-72-1 |
EINECS |
226-778-3 |
Moleküler Yapısı |
|
Yoğunluk |
1.52g/cm3 |
Ergime noktası |
265℃ |
Kaynama noktası |
322.8°C at 760 mmHg |
Kırılma indisi |
1.589 |
Alevlenme noktası |
149°C |
Tehlike Sembolleri |
Xi:Irritant;
|
Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|