ChemNet > CAS > 553-17-3 bis(2-methoxyphenyl) carbonate
553-17-3 bis(2-methoxyphenyl) carbonate
Ürün Adı |
bis(2-methoxyphenyl) carbonate |
Eş anlamlı |
diguaiacyl carbonate; guaiacyl carbonate; Guaiacol carbonate |
Moleküler Formülü |
C15H14O5 |
Molekül Ağırlığı |
274.2687 |
InChI |
InChI=1/C15H14O5/c1-17-11-7-3-5-9-13(11)19-15(16)20-14-10-6-4-8-12(14)18-2/h3-10H,1-2H3 |
CAS kayıt numarası |
553-17-3 |
EINECS |
209-034-2 |
Moleküler Yapısı |
|
Yoğunluk |
1.208g/cm3 |
Kaynama noktası |
392.6°C at 760 mmHg |
Kırılma indisi |
1.552 |
Alevlenme noktası |
173.7°C |
Tehlike Sembolleri |
|
Risk Kodları |
|
Güvenlik Açıklaması |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|