ChemNet > CAS > 553-17-3 bis(2-methoxyphenyl) carbonate
553-17-3 bis(2-methoxyphenyl) carbonate
| Ürün Adı |
bis(2-methoxyphenyl) carbonate |
| Eş anlamlı |
diguaiacyl carbonate; guaiacyl carbonate; Guaiacol carbonate |
| Moleküler Formülü |
C15H14O5 |
| Molekül Ağırlığı |
274.2687 |
| InChI |
InChI=1/C15H14O5/c1-17-11-7-3-5-9-13(11)19-15(16)20-14-10-6-4-8-12(14)18-2/h3-10H,1-2H3 |
| CAS kayıt numarası |
553-17-3 |
| EINECS |
209-034-2 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.208g/cm3 |
| Kaynama noktası |
392.6°C at 760 mmHg |
| Kırılma indisi |
1.552 |
| Alevlenme noktası |
173.7°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
|
| Güvenlik Açıklaması |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
